C15H15F2N3O5 — CID 167809954
methyl 2-[[2-[[4-(difluoromethoxy)-1H-indole-2-carbonyl]amino]acetyl]amino]acetate (PubChem CID 167809954) has the molecular formula C15H15F2N3O5 and a molecular weight of 355.30 g/mol. Its IUPAC name is methyl 2-[[2-[[4-(difluoromethoxy)-1H-indole-2-carbonyl]amino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[4-(difluoromethoxy)-1H-indole-2-carbonyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 167809954 |
| Molecular Formula | C15H15F2N3O5 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | methyl 2-[[2-[[4-(difluoromethoxy)-1H-indole-2-carbonyl]amino]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CNC(=O)c1cc2c(OC(F)F)cccc2[nH]1 |
| InChI | InChI=1S/C15H15F2N3O5/c1-24-13(22)7-18-12(21)6-19-14(23)10-5-8-9(20-10)3-2-4-11(8)25-15(16)17/h2-5,15,20H,6-7H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | LXECNIRYKHEHNZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |