C15H11F2N3O2 — CID 38427829
4-(difluoromethoxy)-N-pyridin-4-yl-1H-indole-2-carboxamide (PubChem CID 38427829) has the molecular formula C15H11F2N3O2 and a molecular weight of 303.27 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-pyridin-4-yl-1H-indole-2-carboxamide.
| Compound Name | 4-(difluoromethoxy)-N-pyridin-4-yl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 38427829 |
| Molecular Formula | C15H11F2N3O2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-(difluoromethoxy)-N-pyridin-4-yl-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1cc2c(OC(F)F)cccc2[nH]1 |
| InChI | InChI=1S/C15H11F2N3O2/c16-15(17)22-13-3-1-2-11-10(13)8-12(20-11)14(21)19-9-4-6-18-7-5-9/h1-8,15,20H,(H,18,19,21) |
| InChIKey | QYVHGKMZKOGWGN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |