C16H19F2N3O3 — CID 167955654
4-(difluoromethoxy)-N-[1-(3-hydroxypyrrolidin-3-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 167955654) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[1-(3-hydroxypyrrolidin-3-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 4-(difluoromethoxy)-N-[1-(3-hydroxypyrrolidin-3-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167955654 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(difluoromethoxy)-N-[1-(3-hydroxypyrrolidin-3-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc2c(OC(F)F)cccc2[nH]1)C1(O)CCNC1 |
| InChI | InChI=1S/C16H19F2N3O3/c1-9(16(23)5-6-19-8-16)20-14(22)12-7-10-11(21-12)3-2-4-13(10)24-15(17)18/h2-4,7,9,15,19,21,23H,5-6,8H2,1H3,(H,20,22) |
| InChIKey | DTWHYLJBWITONR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |