C14H13F2NO2S — CID 47155184
2,5-difluoro-N-[(3-methylphenyl)methyl]benzenesulfonamide (PubChem CID 47155184) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2,5-difluoro-N-[(3-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[(3-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47155184 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2,5-difluoro-N-[(3-methylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1cccc(CNS(=O)(=O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C14H13F2NO2S/c1-10-3-2-4-11(7-10)9-17-20(18,19)14-8-12(15)5-6-13(14)16/h2-8,17H,9H2,1H3 |
| InChIKey | ILSGHWMUKMNLAK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |