C11H10F2N2O2S — CID 106386078
2,5-difluoro-N-(1H-pyrrol-3-ylmethyl)benzenesulfonamide (PubChem CID 106386078) has the molecular formula C11H10F2N2O2S and a molecular weight of 272.28 g/mol. Its IUPAC name is 2,5-difluoro-N-(1H-pyrrol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-(1H-pyrrol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106386078 |
| Molecular Formula | C11H10F2N2O2S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2,5-difluoro-N-(1H-pyrrol-3-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc[nH]c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H10F2N2O2S/c12-9-1-2-10(13)11(5-9)18(16,17)15-7-8-3-4-14-6-8/h1-6,14-15H,7H2 |
| InChIKey | PKJOJRBOOQLACG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |