C16H13F2N3O2S — CID 22205165
2,5-difluoro-N-[(4-pyrazol-1-ylphenyl)methyl]benzenesulfonamide (PubChem CID 22205165) has the molecular formula C16H13F2N3O2S and a molecular weight of 349.36 g/mol. Its IUPAC name is 2,5-difluoro-N-[(4-pyrazol-1-ylphenyl)methyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[(4-pyrazol-1-ylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22205165 |
| Molecular Formula | C16H13F2N3O2S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2,5-difluoro-N-[(4-pyrazol-1-ylphenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(-n2cccn2)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H13F2N3O2S/c17-13-4-7-15(18)16(10-13)24(22,23)20-11-12-2-5-14(6-3-12)21-9-1-8-19-21/h1-10,20H,11H2 |
| InChIKey | NHHZKRTZOSCNFJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |