C12H17NOS — CID 47160172
2-[(2,5-dimethylphenyl)methylsulfanyl]propanamide (PubChem CID 47160172) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methylsulfanyl]propanamide.
| Compound Name | 2-[(2,5-dimethylphenyl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 47160172 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methylsulfanyl]propanamide |
| SMILES | Cc1ccc(C)c(CSC(C)C(N)=O)c1 |
| InChI | InChI=1S/C12H17NOS/c1-8-4-5-9(2)11(6-8)7-15-10(3)12(13)14/h4-6,10H,7H2,1-3H3,(H2,13,14) |
| InChIKey | JNKSPHYFDSKYNY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |