About 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine
2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine (PubChem CID 47165892) has the molecular formula C13H18N4OS
and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine |
| PubChem CID | 47165892 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(SCc2ncc(C(C)(C)C)o2)n1 |
| InChI | InChI=1S/C13H18N4OS/c1-8-5-10(14)17-12(16-8)19-7-11-15-6-9(18-11)13(2,3)4/h5-6H,7H2,1-4H3,(H2,14,16,17) |
| InChIKey | IVPDWMDPTRNLAB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine?
The IUPAC name of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine (CID 47165892) is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine.
What is the SMILES notation for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine?
The canonical SMILES for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine is Cc1cc(N)nc(SCc2ncc(C(C)(C)C)o2)n1.
What is the InChIKey of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine?
The InChIKey is IVPDWMDPTRNLAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4OS/c1-8-5-10(14)17-12(16-8)19-7-11-15-6-9(18-11)13(2,3)4/h5-6H,7H2,1-4H3,(H2,14,16,17).
What are the key properties of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine?
2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine has a molecular weight of 278.38 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-6-methylpyrimidin-4-amine is sourced from PubChem (CID 47165892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).