C13H23N3O3S — CID 47183065
N-[3-[2-methoxyethyl(methyl)amino]propyl]-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 47183065) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[3-[2-methoxyethyl(methyl)amino]propyl]-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-[3-[2-methoxyethyl(methyl)amino]propyl]-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 47183065 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[3-[2-methoxyethyl(methyl)amino]propyl]-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | COCCN(C)CCCNC(=O)Cn1c(C)csc1=O |
| InChI | InChI=1S/C13H23N3O3S/c1-11-10-20-13(18)16(11)9-12(17)14-5-4-6-15(2)7-8-19-3/h10H,4-9H2,1-3H3,(H,14,17) |
| InChIKey | IXDUNZSXMBSSCZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|