C10H13F3N2O3S — CID 78846841
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide (PubChem CID 78846841) has the molecular formula C10H13F3N2O3S and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 78846841 |
| Molecular Formula | C10H13F3N2O3S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O3S/c1-7-5-19-9(17)15(7)4-8(16)14-2-3-18-6-10(11,12)13/h5H,2-4,6H2,1H3,(H,14,16) |
| InChIKey | GHPFHVZBQPGAGK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|