About N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine
N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 47184942) has the molecular formula C9H12N6O
and a molecular weight of 220.24 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 47184942 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | c1cc2nnnn2nc1NCC1CCOC1 |
| InChI | InChI=1S/C9H12N6O/c1-2-9-11-13-14-15(9)12-8(1)10-5-7-3-4-16-6-7/h1-2,7H,3-6H2,(H,10,12) |
| InChIKey | MAVDYZPKTXFPNA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine (CID 47184942) is N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine is c1cc2nnnn2nc1NCC1CCOC1.
What is the InChIKey of N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is MAVDYZPKTXFPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N6O/c1-2-9-11-13-14-15(9)12-8(1)10-5-7-3-4-16-6-7/h1-2,7H,3-6H2,(H,10,12).
What are the key properties of N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine?
N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 220.24 g/mol, XLogP of -0.03, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 47184942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).