C9H12N6O — CID 47184942
N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 47184942) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 47184942 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | N-(oxolan-3-ylmethyl)tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | c1cc2nnnn2nc1NCC1CCOC1 |
| InChI | InChI=1S/C9H12N6O/c1-2-9-11-13-14-15(9)12-8(1)10-5-7-3-4-16-6-7/h1-2,7H,3-6H2,(H,10,12) |
| InChIKey | MAVDYZPKTXFPNA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |