C14H18FN3O2 — CID 47186663
1-(cyclobutylmethyl)-3-[[2-(4-fluorophenyl)acetyl]amino]urea (PubChem CID 47186663) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-3-[[2-(4-fluorophenyl)acetyl]amino]urea.
| Compound Name | 1-(cyclobutylmethyl)-3-[[2-(4-fluorophenyl)acetyl]amino]urea |
|---|---|
| PubChem CID | 47186663 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 1-(cyclobutylmethyl)-3-[[2-(4-fluorophenyl)acetyl]amino]urea |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)NCC1CCC1 |
| InChI | InChI=1S/C14H18FN3O2/c15-12-6-4-10(5-7-12)8-13(19)17-18-14(20)16-9-11-2-1-3-11/h4-7,11H,1-3,8-9H2,(H,17,19)(H2,16,18,20) |
| InChIKey | OUACOQCXRJKKBC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|