C15H14ClNO2 — CID 4719964
4-[[(4-chlorophenyl)methylamino]methyl]benzoic acid (PubChem CID 4719964) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)methylamino]methyl]benzoic acid.
| Compound Name | 4-[[(4-chlorophenyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 4719964 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-[[(4-chlorophenyl)methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H14ClNO2/c16-14-7-3-12(4-8-14)10-17-9-11-1-5-13(6-2-11)15(18)19/h1-8,17H,9-10H2,(H,18,19) |
| InChIKey | OKUKAJBNKVCXOV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |