C15H15Cl2NO2 — CID 2989456
4-[[(3-chlorophenyl)methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 2989456) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is 4-[[(3-chlorophenyl)methylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[(3-chlorophenyl)methylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 2989456 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-[[(3-chlorophenyl)methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CNCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14ClNO2.ClH/c16-14-3-1-2-12(8-14)10-17-9-11-4-6-13(7-5-11)15(18)19;/h1-8,17H,9-10H2,(H,18,19);1H |
| InChIKey | AMKVJVWRYQRWGG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |