C10H18N4O4S2 — CID 47206241
1-(1-methylpyrazol-4-yl)sulfonyl-4-methylsulfonyl-1,4-diazepane (PubChem CID 47206241) has the molecular formula C10H18N4O4S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)sulfonyl-4-methylsulfonyl-1,4-diazepane.
| Compound Name | 1-(1-methylpyrazol-4-yl)sulfonyl-4-methylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 47206241 |
| Molecular Formula | C10H18N4O4S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)sulfonyl-4-methylsulfonyl-1,4-diazepane |
| SMILES | Cn1cc(S(=O)(=O)N2CCCN(S(C)(=O)=O)CC2)cn1 |
| InChI | InChI=1S/C10H18N4O4S2/c1-12-9-10(8-11-12)20(17,18)14-5-3-4-13(6-7-14)19(2,15)16/h8-9H,3-7H2,1-2H3 |
| InChIKey | TYAFIOQXEKYXHI-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |