C12H15N5OS — CID 47211459
2,4-dimethyl-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 47211459) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 47211459 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2,4-dimethyl-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)NCCNc2ncccn2)s1 |
| InChI | InChI=1S/C12H15N5OS/c1-8-10(19-9(2)17-8)11(18)13-6-7-16-12-14-4-3-5-15-12/h3-5H,6-7H2,1-2H3,(H,13,18)(H,14,15,16) |
| InChIKey | NVAFQUCBFQJPHX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|