C10H10ClN5OS — CID 47369952
4-chloro-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 47369952) has the molecular formula C10H10ClN5OS and a molecular weight of 283.74 g/mol. Its IUPAC name is 4-chloro-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-chloro-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 47369952 |
| Molecular Formula | C10H10ClN5OS |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 4-chloro-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCNc1ncccn1)c1scnc1Cl |
| InChI | InChI=1S/C10H10ClN5OS/c11-8-7(18-6-16-8)9(17)12-4-5-15-10-13-2-1-3-14-10/h1-3,6H,4-5H2,(H,12,17)(H,13,14,15) |
| InChIKey | PWDNYMFAFSOYQH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|