C16H22N2OS — CID 47240135
N-(2-adamantyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 47240135) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N-(2-adamantyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-adamantyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 47240135 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-(2-adamantyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)N(C)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H22N2OS/c1-9-15(20-8-17-9)16(19)18(2)14-12-4-10-3-11(6-12)7-13(14)5-10/h8,10-14H,3-7H2,1-2H3 |
| InChIKey | RUEJCORMMNOHBU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |