C15H17F3N2OS — CID 84556529
N-(1-adamantyl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 84556529) has the molecular formula C15H17F3N2OS and a molecular weight of 330.38 g/mol. Its IUPAC name is N-(1-adamantyl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1-adamantyl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 84556529 |
| Molecular Formula | C15H17F3N2OS |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(1-adamantyl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1scnc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2OS/c16-15(17,18)12-11(22-7-19-12)13(21)20-14-4-8-1-9(5-14)3-10(2-8)6-14/h7-10H,1-6H2,(H,20,21) |
| InChIKey | DUEPEZYQNCIBHM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |