C10H13N5OS — CID 47253363
1-(1-imidazol-1-ylpropan-2-yl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 47253363) has the molecular formula C10H13N5OS and a molecular weight of 251.32 g/mol. Its IUPAC name is 1-(1-imidazol-1-ylpropan-2-yl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1-imidazol-1-ylpropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 47253363 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(1-imidazol-1-ylpropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | CC(Cn1ccnc1)NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C10H13N5OS/c1-8(6-15-4-2-11-7-15)13-9(16)14-10-12-3-5-17-10/h2-5,7-8H,6H2,1H3,(H2,12,13,14,16) |
| InChIKey | VTBVCMDIQSJUNA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |