C13H17N5OS — CID 71980952
1-(2-imidazol-1-ylcyclopentyl)-3-(4-methyl-1,3-thiazol-2-yl)urea (PubChem CID 71980952) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylcyclopentyl)-3-(4-methyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(2-imidazol-1-ylcyclopentyl)-3-(4-methyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 71980952 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-(2-imidazol-1-ylcyclopentyl)-3-(4-methyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1csc(NC(=O)NC2CCCC2n2ccnc2)n1 |
| InChI | InChI=1S/C13H17N5OS/c1-9-7-20-13(15-9)17-12(19)16-10-3-2-4-11(10)18-6-5-14-8-18/h5-8,10-11H,2-4H2,1H3,(H2,15,16,17,19) |
| InChIKey | STHJVRNMMQLUDE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |