C13H16ClN3O2S — CID 47254422
2-chloro-N-(cyclopentylmethyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 47254422) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 2-chloro-N-(cyclopentylmethyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(cyclopentylmethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 47254422 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-chloro-N-(cyclopentylmethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCC1)c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C13H16ClN3O2S/c14-12-13(17-8-4-3-7-11(17)16-12)20(18,19)15-9-10-5-1-2-6-10/h3-4,7-8,10,15H,1-2,5-6,9H2 |
| InChIKey | MLYQVSZMTBHJPI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |