C13H16ClN3O2S2 — CID 80596561
2-chloro-N-(thian-2-ylmethyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 80596561) has the molecular formula C13H16ClN3O2S2 and a molecular weight of 345.88 g/mol. Its IUPAC name is 2-chloro-N-(thian-2-ylmethyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(thian-2-ylmethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 80596561 |
| Molecular Formula | C13H16ClN3O2S2 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-chloro-N-(thian-2-ylmethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CCCCS1)c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C13H16ClN3O2S2/c14-12-13(17-7-3-1-6-11(17)16-12)21(18,19)15-9-10-5-2-4-8-20-10/h1,3,6-7,10,15H,2,4-5,8-9H2 |
| InChIKey | ZJDSXFNVXCHSMC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |