C12H13N5O2 — CID 47262469
N-[2-(benzylamino)-2-oxoethyl]-2H-triazole-4-carboxamide (PubChem CID 47262469) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxoethyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[2-(benzylamino)-2-oxoethyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 47262469 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[2-(benzylamino)-2-oxoethyl]-2H-triazole-4-carboxamide |
| SMILES | O=C(CNC(=O)c1cn[nH]n1)NCc1ccccc1 |
| InChI | InChI=1S/C12H13N5O2/c18-11(13-6-9-4-2-1-3-5-9)8-14-12(19)10-7-15-17-16-10/h1-5,7H,6,8H2,(H,13,18)(H,14,19)(H,15,16,17) |
| InChIKey | AZFUUBVVRCJPHW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |