C11H9N5O — CID 47338495
N-[(3-cyanophenyl)methyl]-2H-triazole-4-carboxamide (PubChem CID 47338495) has the molecular formula C11H9N5O and a molecular weight of 227.23 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 47338495 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-2H-triazole-4-carboxamide |
| SMILES | N#Cc1cccc(CNC(=O)c2cn[nH]n2)c1 |
| InChI | InChI=1S/C11H9N5O/c12-5-8-2-1-3-9(4-8)6-13-11(17)10-7-14-16-15-10/h1-4,7H,6H2,(H,13,17)(H,14,15,16) |
| InChIKey | SLWASKUZKWXGAQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |