C12H9N3O2 — CID 55037800
N-[(3-cyanophenyl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 55037800) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 55037800 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | N#Cc1cccc(CNC(=O)c2ccon2)c1 |
| InChI | InChI=1S/C12H9N3O2/c13-7-9-2-1-3-10(6-9)8-14-12(16)11-4-5-17-15-11/h1-6H,8H2,(H,14,16) |
| InChIKey | UWULBHRKZMYIPV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |