C11H16N4O3S — CID 47267301
4-methylsulfonyl-N-pyridin-2-ylpiperazine-1-carboxamide (PubChem CID 47267301) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-methylsulfonyl-N-pyridin-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-methylsulfonyl-N-pyridin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 47267301 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-methylsulfonyl-N-pyridin-2-ylpiperazine-1-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)Nc2ccccn2)CC1 |
| InChI | InChI=1S/C11H16N4O3S/c1-19(17,18)15-8-6-14(7-9-15)11(16)13-10-4-2-3-5-12-10/h2-5H,6-9H2,1H3,(H,12,13,16) |
| InChIKey | HGVHDCOFGVQPOW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |