C12H12N2O4S — CID 47269641
3-(4-methylphenyl)-N-methylsulfonyl-1,2-oxazole-5-carboxamide (PubChem CID 47269641) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-methylsulfonyl-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(4-methylphenyl)-N-methylsulfonyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 47269641 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-(4-methylphenyl)-N-methylsulfonyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NS(C)(=O)=O)on2)cc1 |
| InChI | InChI=1S/C12H12N2O4S/c1-8-3-5-9(6-4-8)10-7-11(18-13-10)12(15)14-19(2,16)17/h3-7H,1-2H3,(H,14,15) |
| InChIKey | SOJYBGIOFPJSRJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |