About N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine
N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 47271585) has the molecular formula C12H20ClN3O2S
and a molecular weight of 305.83 g/mol. Its IUPAC name is N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine |
| PubChem CID | 47271585 |
| Molecular Formula | C12H20ClN3O2S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | CC(C)c1nn(C)c(Cl)c1CNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20ClN3O2S/c1-8(2)11-10(12(13)16(3)15-11)6-14-9-4-5-19(17,18)7-9/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | RTLAQVHHFDHXJP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine?
The IUPAC name of N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine (CID 47271585) is N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine is CC(C)c1nn(C)c(Cl)c1CNC1CCS(=O)(=O)C1.
What is the InChIKey of N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine?
The InChIKey is RTLAQVHHFDHXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClN3O2S/c1-8(2)11-10(12(13)16(3)15-11)6-14-9-4-5-19(17,18)7-9/h8-9,14H,4-7H2,1-3H3.
What are the key properties of N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine?
N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine has a molecular weight of 305.83 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 47271585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).