C10H17N3O2S — CID 66118433
N-[(3-ethylimidazol-4-yl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 66118433) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-[(3-ethylimidazol-4-yl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(3-ethylimidazol-4-yl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 66118433 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-[(3-ethylimidazol-4-yl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | CCn1cncc1CNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17N3O2S/c1-2-13-8-11-5-10(13)6-12-9-3-4-16(14,15)7-9/h5,8-9,12H,2-4,6-7H2,1H3 |
| InChIKey | QQHWWVPGXCLKIV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |