C18H20ClN3O4 — CID 4728574
N'-(4-chloro-3-nitrobenzoyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbohydrazide (PubChem CID 4728574) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is N'-(4-chloro-3-nitrobenzoyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbohydrazide.
| Compound Name | N'-(4-chloro-3-nitrobenzoyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbohydrazide |
|---|---|
| PubChem CID | 4728574 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N'-(4-chloro-3-nitrobenzoyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carbohydrazide |
| SMILES | C=C1C2(C(=O)NNC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)CCC(C2)C1(C)C |
| InChI | InChI=1S/C18H20ClN3O4/c1-10-17(2,3)12-6-7-18(10,9-12)16(24)21-20-15(23)11-4-5-13(19)14(8-11)22(25)26/h4-5,8,12H,1,6-7,9H2,2-3H3,(H,20,23)(H,21,24) |
| InChIKey | UIWBUZBTBPUMSY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|