C20H23ClN4O6 — CID 4731288
N'-(4-chloro-3-nitrobenzoyl)-1,3,5,7-tetramethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carbohydrazide (PubChem CID 4731288) has the molecular formula C20H23ClN4O6 and a molecular weight of 450.88 g/mol. Its IUPAC name is N'-(4-chloro-3-nitrobenzoyl)-1,3,5,7-tetramethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carbohydrazide.
| Compound Name | N'-(4-chloro-3-nitrobenzoyl)-1,3,5,7-tetramethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carbohydrazide |
|---|---|
| PubChem CID | 4731288 |
| Molecular Formula | C20H23ClN4O6 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N'-(4-chloro-3-nitrobenzoyl)-1,3,5,7-tetramethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carbohydrazide |
| SMILES | CN1C(=O)C2(C)CC(C)(C(=O)NNC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)CC(C)(C2)C1=O |
| InChI | InChI=1S/C20H23ClN4O6/c1-18(8-19(2)10-20(3,9-18)17(29)24(4)16(19)28)15(27)23-22-14(26)11-5-6-12(21)13(7-11)25(30)31/h5-7H,8-10H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | YXWJBGZKBASSRY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|