C29H21ClN6O4 — CID 4729286
3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 4729286) has the molecular formula C29H21ClN6O4 and a molecular weight of 552.98 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | 3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4729286 |
| Molecular Formula | C29H21ClN6O4 |
| Molecular Weight | 552.98 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1c(NC(=O)C(C#N)=Cc2c(Oc3ccc(Cl)cc3)nc3ccccn3c2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C29H21ClN6O4/c1-18-25(29(39)36(34(18)2)21-8-4-3-5-9-21)33-26(37)19(17-31)16-23-27(40-22-13-11-20(30)12-14-22)32-24-10-6-7-15-35(24)28(23)38/h3-16H,1-2H3,(H,33,37) |
| InChIKey | RWBWOAOSIRKKPH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|