C25H16FN5O2 — CID 4729298
3-[2-(4-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 4729298) has the molecular formula C25H16FN5O2 and a molecular weight of 437.43 g/mol. Its IUPAC name is 3-[2-(4-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(4-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4729298 |
| Molecular Formula | C25H16FN5O2 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-[2-(4-fluorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cn1c(C(C#N)=Cc2c(Oc3ccc(F)cc3)nc3ccccn3c2=O)nc2ccccc21 |
| InChI | InChI=1S/C25H16FN5O2/c1-30-21-7-3-2-6-20(21)28-23(30)16(15-27)14-19-24(33-18-11-9-17(26)10-12-18)29-22-8-4-5-13-31(22)25(19)32/h2-14H,1H3 |
| InChIKey | RWFPMMUXLTTYKV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|