C26H19N5O3 — CID 4729327
3-[2-(2-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 4729327) has the molecular formula C26H19N5O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is 3-[2-(2-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(2-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4729327 |
| Molecular Formula | C26H19N5O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-[2-(2-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccccc1Oc1nc2ccccn2c(=O)c1C=C(C#N)c1nc2ccccc2n1C |
| InChI | InChI=1S/C26H19N5O3/c1-30-20-10-4-3-9-19(20)28-24(30)17(16-27)15-18-25(34-22-12-6-5-11-21(22)33-2)29-23-13-7-8-14-31(23)26(18)32/h3-15H,1-2H3 |
| InChIKey | RHVFOCHOMSOODY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 94.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|