C26H19N5O2 — CID 6250960
(E)-2-(1H-benzimidazol-2-yl)-3-[2-(2,3-dimethylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile (PubChem CID 6250960) has the molecular formula C26H19N5O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[2-(2,3-dimethylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[2-(2,3-dimethylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6250960 |
| Molecular Formula | C26H19N5O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[2-(2,3-dimethylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
| SMILES | Cc1cccc(Oc2nc3ccccn3c(=O)c2/C=C(\C#N)c2nc3ccccc3[nH]2)c1C |
| InChI | InChI=1S/C26H19N5O2/c1-16-8-7-11-22(17(16)2)33-25-19(26(32)31-13-6-5-12-23(31)30-25)14-18(15-27)24-28-20-9-3-4-10-21(20)29-24/h3-14H,1-2H3,(H,28,29)/b18-14+ |
| InChIKey | BLYTURIVLZZIFN-NBVRZTHBSA-N |
| XLogP | 5.04 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|