C14H22N4 — CID 47299157
4-(2-cyclopentylpyrrolidin-1-yl)-6-methylpyrimidin-2-amine (PubChem CID 47299157) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 4-(2-cyclopentylpyrrolidin-1-yl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(2-cyclopentylpyrrolidin-1-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 47299157 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-(2-cyclopentylpyrrolidin-1-yl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCC2C2CCCC2)nc(N)n1 |
| InChI | InChI=1S/C14H22N4/c1-10-9-13(17-14(15)16-10)18-8-4-7-12(18)11-5-2-3-6-11/h9,11-12H,2-8H2,1H3,(H2,15,16,17) |
| InChIKey | RNHFDGSRWGWQHZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |