C13H16FNO4S — CID 47305546
methyl 1-(4-fluoro-2-methylphenyl)sulfonylpyrrolidine-3-carboxylate (PubChem CID 47305546) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 1-(4-fluoro-2-methylphenyl)sulfonylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-fluoro-2-methylphenyl)sulfonylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 47305546 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | methyl 1-(4-fluoro-2-methylphenyl)sulfonylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C13H16FNO4S/c1-9-7-11(14)3-4-12(9)20(17,18)15-6-5-10(8-15)13(16)19-2/h3-4,7,10H,5-6,8H2,1-2H3 |
| InChIKey | IQJZIKPRDPDRKS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |