C18H20Cl2N2O3 — CID 4731116
N-(2,6-dichlorophenyl)-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide (PubChem CID 4731116) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide |
|---|---|
| PubChem CID | 4731116 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-(2,6-dichlorophenyl)-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide |
| SMILES | CC12CC(C)(CC(C)(C(=O)Nc3c(Cl)cccc3Cl)C1)C(=O)NC2=O |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-16(13(23)21-12-10(19)5-4-6-11(12)20)7-17(2)9-18(3,8-16)15(25)22-14(17)24/h4-6H,7-9H2,1-3H3,(H,21,23)(H,22,24,25) |
| InChIKey | SHDIAWBHZVGVAO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|