C16H15Cl2NO3 — CID 18834452
N-(2,6-dichlorophenyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 18834452) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 18834452 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-(2,6-dichlorophenyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)C2CCC1(C(=O)Nc1c(Cl)cccc1Cl)C(=O)C2=O |
| InChI | InChI=1S/C16H15Cl2NO3/c1-15(2)8-6-7-16(15,13(21)12(8)20)14(22)19-11-9(17)4-3-5-10(11)18/h3-5,8H,6-7H2,1-2H3,(H,19,22) |
| InChIKey | QKTMUFFHJNZEMU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|