C17H17ClN2O4 — CID 18834437
N'-(3-chlorobenzoyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carbohydrazide (PubChem CID 18834437) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is N'-(3-chlorobenzoyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carbohydrazide.
| Compound Name | N'-(3-chlorobenzoyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carbohydrazide |
|---|---|
| PubChem CID | 18834437 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N'-(3-chlorobenzoyl)-7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carbohydrazide |
| SMILES | CC1(C)C2CCC1(C(=O)NNC(=O)c1cccc(Cl)c1)C(=O)C2=O |
| InChI | InChI=1S/C17H17ClN2O4/c1-16(2)11-6-7-17(16,13(22)12(11)21)15(24)20-19-14(23)9-4-3-5-10(18)8-9/h3-5,8,11H,6-7H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | ZNGWOMFGIAZUSW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|