C16H13ClN2O3 — CID 9086711
(2S)-N'-(3-chlorobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 9086711) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is (2S)-N'-(3-chlorobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | (2S)-N'-(3-chlorobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 9086711 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (2S)-N'-(3-chlorobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1Cc2ccccc2O1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClN2O3/c17-12-6-3-5-11(8-12)15(20)18-19-16(21)14-9-10-4-1-2-7-13(10)22-14/h1-8,14H,9H2,(H,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | DTNUYOWDNADFCF-AWEZNQCLSA-N |
| XLogP | 2.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|