C16H12Cl2N2O3 — CID 9087960
(2S)-N'-(2,5-dichlorobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 9087960) has the molecular formula C16H12Cl2N2O3 and a molecular weight of 351.19 g/mol. Its IUPAC name is (2S)-N'-(2,5-dichlorobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | (2S)-N'-(2,5-dichlorobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 9087960 |
| Molecular Formula | C16H12Cl2N2O3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | (2S)-N'-(2,5-dichlorobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1Cc2ccccc2O1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O3/c17-10-5-6-12(18)11(8-10)15(21)19-20-16(22)14-7-9-3-1-2-4-13(9)23-14/h1-6,8,14H,7H2,(H,19,21)(H,20,22)/t14-/m0/s1 |
| InChIKey | MODCECKLIMEZGI-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|