About N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide
N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 86874325) has the molecular formula C22H19N3O3
and a molecular weight of 373.41 g/mol. Its IUPAC name is N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide.
Molecular Properties
| Compound Name | N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
| PubChem CID | 86874325 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1Cc2ccccc2O1)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C22H19N3O3/c26-21(17-11-5-6-12-18(17)23-16-9-2-1-3-10-16)24-25-22(27)20-14-15-8-4-7-13-19(15)28-20/h1-13,20,23H,14H2,(H,24,26)(H,25,27) |
| InChIKey | MGAJWSRAHMULRK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide?
The IUPAC name of N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide (CID 86874325) is N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide.
What is the SMILES notation for N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide?
The canonical SMILES for N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide is O=C(NNC(=O)C1Cc2ccccc2O1)c1ccccc1Nc1ccccc1.
What is the InChIKey of N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide?
The InChIKey is MGAJWSRAHMULRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3/c26-21(17-11-5-6-12-18(17)23-16-9-2-1-3-10-16)24-25-22(27)20-14-15-8-4-7-13-19(15)28-20/h1-13,20,23H,14H2,(H,24,26)(H,25,27).
What are the key properties of N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide?
N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide has a molecular weight of 373.41 g/mol, XLogP of 3.19, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-anilinobenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide is sourced from PubChem (CID 86874325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).