C16H15NO2 — CID 8872415
(2S)-N-(2-methylphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 8872415) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2S)-N-(2-methylphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2S)-N-(2-methylphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8872415 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2S)-N-(2-methylphenyl)-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C16H15NO2/c1-11-6-2-4-8-13(11)17-16(18)15-10-12-7-3-5-9-14(12)19-15/h2-9,15H,10H2,1H3,(H,17,18)/t15-/m0/s1 |
| InChIKey | RTSHMVURJFRDIG-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |