C18H20N2O5 — CID 18834443
7,7-dimethyl-2,3-dioxo-N'-(2-phenoxyacetyl)bicyclo[2.2.1]heptane-1-carbohydrazide (PubChem CID 18834443) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 7,7-dimethyl-2,3-dioxo-N'-(2-phenoxyacetyl)bicyclo[2.2.1]heptane-1-carbohydrazide.
| Compound Name | 7,7-dimethyl-2,3-dioxo-N'-(2-phenoxyacetyl)bicyclo[2.2.1]heptane-1-carbohydrazide |
|---|---|
| PubChem CID | 18834443 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 7,7-dimethyl-2,3-dioxo-N'-(2-phenoxyacetyl)bicyclo[2.2.1]heptane-1-carbohydrazide |
| SMILES | CC1(C)C2CCC1(C(=O)NNC(=O)COc1ccccc1)C(=O)C2=O |
| InChI | InChI=1S/C18H20N2O5/c1-17(2)12-8-9-18(17,15(23)14(12)22)16(24)20-19-13(21)10-25-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,19,21)(H,20,24) |
| InChIKey | XBROIAGIKHMDFT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|