C19H23N3O5 — CID 4731255
1,3,5,7-tetramethyl-N-(4-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide (PubChem CID 4731255) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1,3,5,7-tetramethyl-N-(4-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide.
| Compound Name | 1,3,5,7-tetramethyl-N-(4-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide |
|---|---|
| PubChem CID | 4731255 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1,3,5,7-tetramethyl-N-(4-nitrophenyl)-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide |
| SMILES | CN1C(=O)C2(C)CC(C)(C(=O)Nc3ccc([N+](=O)[O-])cc3)CC(C)(C2)C1=O |
| InChI | InChI=1S/C19H23N3O5/c1-17(14(23)20-12-5-7-13(8-6-12)22(26)27)9-18(2)11-19(3,10-17)16(25)21(4)15(18)24/h5-8H,9-11H2,1-4H3,(H,20,23) |
| InChIKey | HUWHXMNISQPPRP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|