C22H13NO2S2 — CID 4731585
naphthalen-2-yl 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate (PubChem CID 4731585) has the molecular formula C22H13NO2S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is naphthalen-2-yl 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate.
| Compound Name | naphthalen-2-yl 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4731585 |
| Molecular Formula | C22H13NO2S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | naphthalen-2-yl 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc2ccccc2c1)c1ccc(-c2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C22H13NO2S2/c24-22(25-16-10-9-14-5-1-2-6-15(14)13-16)20-12-11-19(26-20)21-23-17-7-3-4-8-18(17)27-21/h1-13H |
| InChIKey | BYXBQNPSDPKFPD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|