C22H20ClN3OS — CID 4732004
N-(5-chloro-2-methylphenyl)-5-(1-propylbenzimidazol-2-yl)thiophene-2-carboxamide (PubChem CID 4732004) has the molecular formula C22H20ClN3OS and a molecular weight of 409.94 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-5-(1-propylbenzimidazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-5-(1-propylbenzimidazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4732004 |
| Molecular Formula | C22H20ClN3OS |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-5-(1-propylbenzimidazol-2-yl)thiophene-2-carboxamide |
| SMILES | CCCn1c(-c2ccc(C(=O)Nc3cc(Cl)ccc3C)s2)nc2ccccc21 |
| InChI | InChI=1S/C22H20ClN3OS/c1-3-12-26-18-7-5-4-6-16(18)24-21(26)19-10-11-20(28-19)22(27)25-17-13-15(23)9-8-14(17)2/h4-11,13H,3,12H2,1-2H3,(H,25,27) |
| InChIKey | KKSCYJXDNMQHPB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |