C22H22N4O3S2 — CID 4732104
N'-(4-methylphenyl)sulfonyl-5-(1-propylbenzimidazol-2-yl)thiophene-2-carbohydrazide (PubChem CID 4732104) has the molecular formula C22H22N4O3S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-5-(1-propylbenzimidazol-2-yl)thiophene-2-carbohydrazide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-5-(1-propylbenzimidazol-2-yl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4732104 |
| Molecular Formula | C22H22N4O3S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-5-(1-propylbenzimidazol-2-yl)thiophene-2-carbohydrazide |
| SMILES | CCCn1c(-c2ccc(C(=O)NNS(=O)(=O)c3ccc(C)cc3)s2)nc2ccccc21 |
| InChI | InChI=1S/C22H22N4O3S2/c1-3-14-26-18-7-5-4-6-17(18)23-21(26)19-12-13-20(30-19)22(27)24-25-31(28,29)16-10-8-15(2)9-11-16/h4-13,25H,3,14H2,1-2H3,(H,24,27) |
| InChIKey | XPOWLVLJJHSIHX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|